About N-(4-cyanophenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide
N-(4-cyanophenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide (PubChem CID 2741509) has the molecular formula C13H11N3O2
and a molecular weight of 241.25 g/mol. Its IUPAC name is N-(4-cyanophenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(4-cyanophenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide |
| PubChem CID | 2741509 |
| Molecular Formula | C13H11N3O2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | N-(4-cyanophenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1noc(C)c1C(=O)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C13H11N3O2/c1-8-12(9(2)18-16-8)13(17)15-11-5-3-10(7-14)4-6-11/h3-6H,1-2H3,(H,15,17) |
| InChIKey | ILOWXTHMAGRAQL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(4-cyanophenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-cyanophenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide?
The IUPAC name of N-(4-cyanophenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide (CID 2741509) is N-(4-cyanophenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide.
What is the SMILES notation for N-(4-cyanophenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide?
The canonical SMILES for N-(4-cyanophenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide is Cc1noc(C)c1C(=O)Nc1ccc(C#N)cc1.
What is the InChIKey of N-(4-cyanophenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide?
The InChIKey is ILOWXTHMAGRAQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3O2/c1-8-12(9(2)18-16-8)13(17)15-11-5-3-10(7-14)4-6-11/h3-6H,1-2H3,(H,15,17).
What are the key properties of N-(4-cyanophenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide?
N-(4-cyanophenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide has a molecular weight of 241.25 g/mol, XLogP of 2.42, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-cyanophenyl)-3,5-dimethyl-1,2-oxazole-4-carboxamide is sourced from PubChem (CID 2741509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).