C17H19F3N6S — CID 2741788
1-methyl-3-[6-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-3-pyridinyl]thiourea (PubChem CID 2741788) has the molecular formula C17H19F3N6S and a molecular weight of 396.44 g/mol. Its IUPAC name is 1-methyl-3-[6-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-3-pyridinyl]thiourea.
| Compound Name | 1-methyl-3-[6-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-3-pyridinyl]thiourea |
|---|---|
| PubChem CID | 2741788 |
| Molecular Formula | C17H19F3N6S |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 1-methyl-3-[6-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-3-pyridinyl]thiourea |
| SMILES | CNC(=S)Nc1ccc(N2CCN(c3ccc(C(F)(F)F)cn3)CC2)nc1 |
| InChI | InChI=1S/C17H19F3N6S/c1-21-16(27)24-13-3-5-15(23-11-13)26-8-6-25(7-9-26)14-4-2-12(10-22-14)17(18,19)20/h2-5,10-11H,6-9H2,1H3,(H2,21,24,27) |
| InChIKey | IUOUWXVONQXGMI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|