C21H18ClNO6S — CID 27418546
3-[4-[(E)-[3-[(2-chlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]propanoic acid (PubChem CID 27418546) has the molecular formula C21H18ClNO6S and a molecular weight of 447.90 g/mol. Its IUPAC name is 3-[4-[(E)-[3-[(2-chlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]propanoic acid.
| Compound Name | 3-[4-[(E)-[3-[(2-chlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]propanoic acid |
|---|---|
| PubChem CID | 27418546 |
| Molecular Formula | C21H18ClNO6S |
| Molecular Weight | 447.90 g/mol |
| Exact Mass | 447.05 |
| IUPAC Name | 3-[4-[(E)-[3-[(2-chlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]propanoic acid |
| SMILES | COc1cc(/C=C2/SC(=O)N(Cc3ccccc3Cl)C2=O)ccc1OCCC(=O)O |
| InChI | InChI=1S/C21H18ClNO6S/c1-28-17-10-13(6-7-16(17)29-9-8-19(24)25)11-18-20(26)23(21(27)30-18)12-14-4-2-3-5-15(14)22/h2-7,10-11H,8-9,12H2,1H3,(H,24,25)/b18-11+ |
| InChIKey | MQUOVMLBXCUQTH-WOJGMQOQSA-N |
| XLogP | 4.44 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.90 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|