About 1-(4-bromophenyl)-3,5-ditert-butylpyrazole
1-(4-bromophenyl)-3,5-ditert-butylpyrazole (PubChem CID 2742099) has the molecular formula C17H23BrN2
and a molecular weight of 335.29 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3,5-ditert-butylpyrazole.
Molecular Properties
| Compound Name | 1-(4-bromophenyl)-3,5-ditert-butylpyrazole |
| PubChem CID | 2742099 |
| Molecular Formula | C17H23BrN2 |
| Molecular Weight | 335.29 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 1-(4-bromophenyl)-3,5-ditert-butylpyrazole |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)n(-c2ccc(Br)cc2)n1 |
| InChI | InChI=1S/C17H23BrN2/c1-16(2,3)14-11-15(17(4,5)6)20(19-14)13-9-7-12(18)8-10-13/h7-11H,1-6H3 |
| InChIKey | PAVNRWRYJWCWAN-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.29 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-bromophenyl)-3,5-ditert-butylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromophenyl)-3,5-ditert-butylpyrazole?
The IUPAC name of 1-(4-bromophenyl)-3,5-ditert-butylpyrazole (CID 2742099) is 1-(4-bromophenyl)-3,5-ditert-butylpyrazole.
What is the SMILES notation for 1-(4-bromophenyl)-3,5-ditert-butylpyrazole?
The canonical SMILES for 1-(4-bromophenyl)-3,5-ditert-butylpyrazole is CC(C)(C)c1cc(C(C)(C)C)n(-c2ccc(Br)cc2)n1.
What is the InChIKey of 1-(4-bromophenyl)-3,5-ditert-butylpyrazole?
The InChIKey is PAVNRWRYJWCWAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23BrN2/c1-16(2,3)14-11-15(17(4,5)6)20(19-14)13-9-7-12(18)8-10-13/h7-11H,1-6H3.
What are the key properties of 1-(4-bromophenyl)-3,5-ditert-butylpyrazole?
1-(4-bromophenyl)-3,5-ditert-butylpyrazole has a molecular weight of 335.29 g/mol, XLogP of 5.23, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromophenyl)-3,5-ditert-butylpyrazole is sourced from PubChem (CID 2742099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).