About N-(3,5-dimethylphenyl)-2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3-carboxamide
N-(3,5-dimethylphenyl)-2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3-carboxamide (PubChem CID 2742292) has the molecular formula C20H22N2OS
and a molecular weight of 338.48 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3-carboxamide.
Molecular Properties
| Compound Name | N-(3,5-dimethylphenyl)-2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3-carboxamide |
| PubChem CID | 2742292 |
| Molecular Formula | C20H22N2OS |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | N-(3,5-dimethylphenyl)-2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3-carboxamide |
| SMILES | Cc1cc(C)cc(NC(=O)c2cc(C)n(Cc3cccs3)c2C)c1 |
| InChI | InChI=1S/C20H22N2OS/c1-13-8-14(2)10-17(9-13)21-20(23)19-11-15(3)22(16(19)4)12-18-6-5-7-24-18/h5-11H,12H2,1-4H3,(H,21,23) |
| InChIKey | RBBZRAXJMSUNJB-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3,5-dimethylphenyl)-2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,5-dimethylphenyl)-2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3-carboxamide?
The IUPAC name of N-(3,5-dimethylphenyl)-2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3-carboxamide (CID 2742292) is N-(3,5-dimethylphenyl)-2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3-carboxamide.
What is the SMILES notation for N-(3,5-dimethylphenyl)-2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3-carboxamide?
The canonical SMILES for N-(3,5-dimethylphenyl)-2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3-carboxamide is Cc1cc(C)cc(NC(=O)c2cc(C)n(Cc3cccs3)c2C)c1.
What is the InChIKey of N-(3,5-dimethylphenyl)-2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3-carboxamide?
The InChIKey is RBBZRAXJMSUNJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N2OS/c1-13-8-14(2)10-17(9-13)21-20(23)19-11-15(3)22(16(19)4)12-18-6-5-7-24-18/h5-11H,12H2,1-4H3,(H,21,23).
What are the key properties of N-(3,5-dimethylphenyl)-2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3-carboxamide?
N-(3,5-dimethylphenyl)-2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3-carboxamide has a molecular weight of 338.48 g/mol, XLogP of 5.08, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,5-dimethylphenyl)-2,5-dimethyl-1-(thiophen-2-ylmethyl)pyrrole-3-carboxamide is sourced from PubChem (CID 2742292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).