About 2,6-ditert-butyl-4-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]phenol
2,6-ditert-butyl-4-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]phenol (PubChem CID 2742349) has the molecular formula C23H26ClNOS
and a molecular weight of 399.99 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]phenol.
Molecular Properties
| Compound Name | 2,6-ditert-butyl-4-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]phenol |
| PubChem CID | 2742349 |
| Molecular Formula | C23H26ClNOS |
| Molecular Weight | 399.99 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 2,6-ditert-butyl-4-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]phenol |
| SMILES | CC(C)(C)c1cc(-c2csc(-c3ccc(Cl)cc3)n2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C23H26ClNOS/c1-22(2,3)17-11-15(12-18(20(17)26)23(4,5)6)19-13-27-21(25-19)14-7-9-16(24)10-8-14/h7-13,26H,1-6H3 |
| InChIKey | TVZAKLQPQXJCAD-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.99 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,6-ditert-butyl-4-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-ditert-butyl-4-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]phenol?
The IUPAC name of 2,6-ditert-butyl-4-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]phenol (CID 2742349) is 2,6-ditert-butyl-4-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]phenol.
What is the SMILES notation for 2,6-ditert-butyl-4-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]phenol?
The canonical SMILES for 2,6-ditert-butyl-4-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]phenol is CC(C)(C)c1cc(-c2csc(-c3ccc(Cl)cc3)n2)cc(C(C)(C)C)c1O.
What is the InChIKey of 2,6-ditert-butyl-4-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]phenol?
The InChIKey is TVZAKLQPQXJCAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26ClNOS/c1-22(2,3)17-11-15(12-18(20(17)26)23(4,5)6)19-13-27-21(25-19)14-7-9-16(24)10-8-14/h7-13,26H,1-6H3.
What are the key properties of 2,6-ditert-butyl-4-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]phenol?
2,6-ditert-butyl-4-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]phenol has a molecular weight of 399.99 g/mol, XLogP of 7.43, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-ditert-butyl-4-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]phenol is sourced from PubChem (CID 2742349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).