C12H10N2S — CID 2742455
2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]acetonitrile (PubChem CID 2742455) has the molecular formula C12H10N2S and a molecular weight of 214.29 g/mol. Its IUPAC name is 2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]acetonitrile.
| Compound Name | 2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]acetonitrile |
|---|---|
| PubChem CID | 2742455 |
| Molecular Formula | C12H10N2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 2-[4-(4-methylphenyl)-1,3-thiazol-2-yl]acetonitrile |
| SMILES | Cc1ccc(-c2csc(CC#N)n2)cc1 |
| InChI | InChI=1S/C12H10N2S/c1-9-2-4-10(5-3-9)11-8-15-12(14-11)6-7-13/h2-5,8H,6H2,1H3 |
| InChIKey | YMRPDXAXRLGWDN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |