About 5-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-1,2-oxazole
5-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-1,2-oxazole (PubChem CID 2742521) has the molecular formula C12H7FN2OS
and a molecular weight of 246.27 g/mol. Its IUPAC name is 5-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-1,2-oxazole.
Molecular Properties
| Compound Name | 5-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-1,2-oxazole |
| PubChem CID | 2742521 |
| Molecular Formula | C12H7FN2OS |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | 5-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-1,2-oxazole |
| SMILES | Fc1cccc(-c2csc(-c3ccno3)n2)c1 |
| InChI | InChI=1S/C12H7FN2OS/c13-9-3-1-2-8(6-9)10-7-17-12(15-10)11-4-5-14-16-11/h1-7H |
| InChIKey | GDZNGCPCWRMUMS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-1,2-oxazole?
The IUPAC name of 5-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-1,2-oxazole (CID 2742521) is 5-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-1,2-oxazole.
What is the SMILES notation for 5-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-1,2-oxazole?
The canonical SMILES for 5-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-1,2-oxazole is Fc1cccc(-c2csc(-c3ccno3)n2)c1.
What is the InChIKey of 5-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-1,2-oxazole?
The InChIKey is GDZNGCPCWRMUMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7FN2OS/c13-9-3-1-2-8(6-9)10-7-17-12(15-10)11-4-5-14-16-11/h1-7H.
What are the key properties of 5-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-1,2-oxazole?
5-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-1,2-oxazole has a molecular weight of 246.27 g/mol, XLogP of 3.60, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]-1,2-oxazole is sourced from PubChem (CID 2742521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).