About 3-[5-(4-methylpiperazin-1-yl)sulfonylthiophen-2-yl]-5-(trifluoromethyl)-1,2-oxazole
3-[5-(4-methylpiperazin-1-yl)sulfonylthiophen-2-yl]-5-(trifluoromethyl)-1,2-oxazole (PubChem CID 2742815) has the molecular formula C13H14F3N3O3S2
and a molecular weight of 381.40 g/mol. Its IUPAC name is 3-[5-(4-methylpiperazin-1-yl)sulfonylthiophen-2-yl]-5-(trifluoromethyl)-1,2-oxazole.
Molecular Properties
| Compound Name | 3-[5-(4-methylpiperazin-1-yl)sulfonylthiophen-2-yl]-5-(trifluoromethyl)-1,2-oxazole |
| PubChem CID | 2742815 |
| Molecular Formula | C13H14F3N3O3S2 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | 3-[5-(4-methylpiperazin-1-yl)sulfonylthiophen-2-yl]-5-(trifluoromethyl)-1,2-oxazole |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(-c3cc(C(F)(F)F)on3)s2)CC1 |
| InChI | InChI=1S/C13H14F3N3O3S2/c1-18-4-6-19(7-5-18)24(20,21)12-3-2-10(23-12)9-8-11(22-17-9)13(14,15)16/h2-3,8H,4-7H2,1H3 |
| InChIKey | XPFLWRGGOSKSLI-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[5-(4-methylpiperazin-1-yl)sulfonylthiophen-2-yl]-5-(trifluoromethyl)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(4-methylpiperazin-1-yl)sulfonylthiophen-2-yl]-5-(trifluoromethyl)-1,2-oxazole?
The IUPAC name of 3-[5-(4-methylpiperazin-1-yl)sulfonylthiophen-2-yl]-5-(trifluoromethyl)-1,2-oxazole (CID 2742815) is 3-[5-(4-methylpiperazin-1-yl)sulfonylthiophen-2-yl]-5-(trifluoromethyl)-1,2-oxazole.
What is the SMILES notation for 3-[5-(4-methylpiperazin-1-yl)sulfonylthiophen-2-yl]-5-(trifluoromethyl)-1,2-oxazole?
The canonical SMILES for 3-[5-(4-methylpiperazin-1-yl)sulfonylthiophen-2-yl]-5-(trifluoromethyl)-1,2-oxazole is CN1CCN(S(=O)(=O)c2ccc(-c3cc(C(F)(F)F)on3)s2)CC1.
What is the InChIKey of 3-[5-(4-methylpiperazin-1-yl)sulfonylthiophen-2-yl]-5-(trifluoromethyl)-1,2-oxazole?
The InChIKey is XPFLWRGGOSKSLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F3N3O3S2/c1-18-4-6-19(7-5-18)24(20,21)12-3-2-10(23-12)9-8-11(22-17-9)13(14,15)16/h2-3,8H,4-7H2,1H3.
What are the key properties of 3-[5-(4-methylpiperazin-1-yl)sulfonylthiophen-2-yl]-5-(trifluoromethyl)-1,2-oxazole?
3-[5-(4-methylpiperazin-1-yl)sulfonylthiophen-2-yl]-5-(trifluoromethyl)-1,2-oxazole has a molecular weight of 381.40 g/mol, XLogP of 2.36, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(4-methylpiperazin-1-yl)sulfonylthiophen-2-yl]-5-(trifluoromethyl)-1,2-oxazole is sourced from PubChem (CID 2742815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).