C23H20N2O7S — CID 27430092
4-[[(5Z)-5-[[3-(2-carboxyethoxy)phenyl]methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]-2-hydroxybenzoic acid (PubChem CID 27430092) has the molecular formula C23H20N2O7S and a molecular weight of 468.49 g/mol. Its IUPAC name is 4-[[(5Z)-5-[[3-(2-carboxyethoxy)phenyl]methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]-2-hydroxybenzoic acid.
| Compound Name | 4-[[(5Z)-5-[[3-(2-carboxyethoxy)phenyl]methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 27430092 |
| Molecular Formula | C23H20N2O7S |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | 4-[[(5Z)-5-[[3-(2-carboxyethoxy)phenyl]methylidene]-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]-2-hydroxybenzoic acid |
| SMILES | C=CCN1C(=O)/C(=C/c2cccc(OCCC(=O)O)c2)S/C1=N/c1ccc(C(=O)O)c(O)c1 |
| InChI | InChI=1S/C23H20N2O7S/c1-2-9-25-21(29)19(12-14-4-3-5-16(11-14)32-10-8-20(27)28)33-23(25)24-15-6-7-17(22(30)31)18(26)13-15/h2-7,11-13,26H,1,8-10H2,(H,27,28)(H,30,31)/b19-12-,24-23+ |
| InChIKey | XPMPXJVRLAVIMP-OBVMKBCJSA-N |
| XLogP | 3.73 |
| TPSA | 136.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|