C9H12N6OS — CID 2743422
2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-N'-hydroxyethanimidamide (PubChem CID 2743422) has the molecular formula C9H12N6OS and a molecular weight of 252.30 g/mol. Its IUPAC name is 2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-N'-hydroxyethanimidamide.
| Compound Name | 2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 2743422 |
| Molecular Formula | C9H12N6OS |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]-N'-hydroxyethanimidamide |
| SMILES | Cc1cc(C)n2nc(SCC(N)=NO)nc2n1 |
| InChI | InChI=1S/C9H12N6OS/c1-5-3-6(2)15-8(11-5)12-9(13-15)17-4-7(10)14-16/h3,16H,4H2,1-2H3,(H2,10,14) |
| InChIKey | BIYOGLXHGOKMQB-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 101.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|