About [1-(1,3-dithiolan-2-yl)naphthalen-2-yl] 4-tert-butylbenzoate
[1-(1,3-dithiolan-2-yl)naphthalen-2-yl] 4-tert-butylbenzoate (PubChem CID 2743427) has the molecular formula C24H24O2S2
and a molecular weight of 408.59 g/mol. Its IUPAC name is [1-(1,3-dithiolan-2-yl)naphthalen-2-yl] 4-tert-butylbenzoate.
Molecular Properties
| Compound Name | [1-(1,3-dithiolan-2-yl)naphthalen-2-yl] 4-tert-butylbenzoate |
| PubChem CID | 2743427 |
| Molecular Formula | C24H24O2S2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | [1-(1,3-dithiolan-2-yl)naphthalen-2-yl] 4-tert-butylbenzoate |
| SMILES | CC(C)(C)c1ccc(C(=O)Oc2ccc3ccccc3c2C2SCCS2)cc1 |
| InChI | InChI=1S/C24H24O2S2/c1-24(2,3)18-11-8-17(9-12-18)22(25)26-20-13-10-16-6-4-5-7-19(16)21(20)23-27-14-15-28-23/h4-13,23H,14-15H2,1-3H3 |
| InChIKey | AEYISSXLWWDWKO-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [1-(1,3-dithiolan-2-yl)naphthalen-2-yl] 4-tert-butylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(1,3-dithiolan-2-yl)naphthalen-2-yl] 4-tert-butylbenzoate?
The IUPAC name of [1-(1,3-dithiolan-2-yl)naphthalen-2-yl] 4-tert-butylbenzoate (CID 2743427) is [1-(1,3-dithiolan-2-yl)naphthalen-2-yl] 4-tert-butylbenzoate.
What is the SMILES notation for [1-(1,3-dithiolan-2-yl)naphthalen-2-yl] 4-tert-butylbenzoate?
The canonical SMILES for [1-(1,3-dithiolan-2-yl)naphthalen-2-yl] 4-tert-butylbenzoate is CC(C)(C)c1ccc(C(=O)Oc2ccc3ccccc3c2C2SCCS2)cc1.
What is the InChIKey of [1-(1,3-dithiolan-2-yl)naphthalen-2-yl] 4-tert-butylbenzoate?
The InChIKey is AEYISSXLWWDWKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24O2S2/c1-24(2,3)18-11-8-17(9-12-18)22(25)26-20-13-10-16-6-4-5-7-19(16)21(20)23-27-14-15-28-23/h4-13,23H,14-15H2,1-3H3.
What are the key properties of [1-(1,3-dithiolan-2-yl)naphthalen-2-yl] 4-tert-butylbenzoate?
[1-(1,3-dithiolan-2-yl)naphthalen-2-yl] 4-tert-butylbenzoate has a molecular weight of 408.59 g/mol, XLogP of 6.84, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(1,3-dithiolan-2-yl)naphthalen-2-yl] 4-tert-butylbenzoate is sourced from PubChem (CID 2743427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).