C12H11NO3 — CID 27435
4-(ethoxymethylidene)-2-phenyl-1,3-oxazol-5-one (PubChem CID 27435) has the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. Its IUPAC name is 4-(ethoxymethylidene)-2-phenyl-1,3-oxazol-5-one.
| Compound Name | 4-(ethoxymethylidene)-2-phenyl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 27435 |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 4-(ethoxymethylidene)-2-phenyl-1,3-oxazol-5-one |
| SMILES | CCOC=C1N=C(c2ccccc2)OC1=O |
| InChI | InChI=1S/C12H11NO3/c1-2-15-8-10-12(14)16-11(13-10)9-6-4-3-5-7-9/h3-8H,2H2,1H3 |
| InChIKey | SJHPCNCNNSSLPL-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|