About 1-butyl-3-[(5-methyl-1,2-oxazole-3-carbonyl)amino]urea
1-butyl-3-[(5-methyl-1,2-oxazole-3-carbonyl)amino]urea (PubChem CID 2743501) has the molecular formula C10H16N4O3
and a molecular weight of 240.26 g/mol. Its IUPAC name is 1-butyl-3-[(5-methyl-1,2-oxazole-3-carbonyl)amino]urea.
Molecular Properties
| Compound Name | 1-butyl-3-[(5-methyl-1,2-oxazole-3-carbonyl)amino]urea |
| PubChem CID | 2743501 |
| Molecular Formula | C10H16N4O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 1-butyl-3-[(5-methyl-1,2-oxazole-3-carbonyl)amino]urea |
| SMILES | CCCCNC(=O)NNC(=O)c1cc(C)on1 |
| InChI | InChI=1S/C10H16N4O3/c1-3-4-5-11-10(16)13-12-9(15)8-6-7(2)17-14-8/h6H,3-5H2,1-2H3,(H,12,15)(H2,11,13,16) |
| InChIKey | YVTWZZWXXMBUDF-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-[(5-methyl-1,2-oxazole-3-carbonyl)amino]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-[(5-methyl-1,2-oxazole-3-carbonyl)amino]urea?
The IUPAC name of 1-butyl-3-[(5-methyl-1,2-oxazole-3-carbonyl)amino]urea (CID 2743501) is 1-butyl-3-[(5-methyl-1,2-oxazole-3-carbonyl)amino]urea.
What is the SMILES notation for 1-butyl-3-[(5-methyl-1,2-oxazole-3-carbonyl)amino]urea?
The canonical SMILES for 1-butyl-3-[(5-methyl-1,2-oxazole-3-carbonyl)amino]urea is CCCCNC(=O)NNC(=O)c1cc(C)on1.
What is the InChIKey of 1-butyl-3-[(5-methyl-1,2-oxazole-3-carbonyl)amino]urea?
The InChIKey is YVTWZZWXXMBUDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4O3/c1-3-4-5-11-10(16)13-12-9(15)8-6-7(2)17-14-8/h6H,3-5H2,1-2H3,(H,12,15)(H2,11,13,16).
What are the key properties of 1-butyl-3-[(5-methyl-1,2-oxazole-3-carbonyl)amino]urea?
1-butyl-3-[(5-methyl-1,2-oxazole-3-carbonyl)amino]urea has a molecular weight of 240.26 g/mol, XLogP of 0.73, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-[(5-methyl-1,2-oxazole-3-carbonyl)amino]urea is sourced from PubChem (CID 2743501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).