About methyl N-[(5-methyl-1,2-oxazole-3-carbonyl)amino]carbamodithioate
methyl N-[(5-methyl-1,2-oxazole-3-carbonyl)amino]carbamodithioate (PubChem CID 2743511) has the molecular formula C7H9N3O2S2
and a molecular weight of 231.30 g/mol. Its IUPAC name is methyl N-[(5-methyl-1,2-oxazole-3-carbonyl)amino]carbamodithioate.
Molecular Properties
| Compound Name | methyl N-[(5-methyl-1,2-oxazole-3-carbonyl)amino]carbamodithioate |
| PubChem CID | 2743511 |
| Molecular Formula | C7H9N3O2S2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.01 |
| IUPAC Name | methyl N-[(5-methyl-1,2-oxazole-3-carbonyl)amino]carbamodithioate |
| SMILES | CSC(=S)NNC(=O)c1cc(C)on1 |
| InChI | InChI=1S/C7H9N3O2S2/c1-4-3-5(10-12-4)6(11)8-9-7(13)14-2/h3H,1-2H3,(H,8,11)(H,9,13) |
| InChIKey | USVMCYGYQHGQAM-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze methyl N-[(5-methyl-1,2-oxazole-3-carbonyl)amino]carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[(5-methyl-1,2-oxazole-3-carbonyl)amino]carbamodithioate?
The IUPAC name of methyl N-[(5-methyl-1,2-oxazole-3-carbonyl)amino]carbamodithioate (CID 2743511) is methyl N-[(5-methyl-1,2-oxazole-3-carbonyl)amino]carbamodithioate.
What is the SMILES notation for methyl N-[(5-methyl-1,2-oxazole-3-carbonyl)amino]carbamodithioate?
The canonical SMILES for methyl N-[(5-methyl-1,2-oxazole-3-carbonyl)amino]carbamodithioate is CSC(=S)NNC(=O)c1cc(C)on1.
What is the InChIKey of methyl N-[(5-methyl-1,2-oxazole-3-carbonyl)amino]carbamodithioate?
The InChIKey is USVMCYGYQHGQAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O2S2/c1-4-3-5(10-12-4)6(11)8-9-7(13)14-2/h3H,1-2H3,(H,8,11)(H,9,13).
What are the key properties of methyl N-[(5-methyl-1,2-oxazole-3-carbonyl)amino]carbamodithioate?
methyl N-[(5-methyl-1,2-oxazole-3-carbonyl)amino]carbamodithioate has a molecular weight of 231.30 g/mol, XLogP of 0.87, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[(5-methyl-1,2-oxazole-3-carbonyl)amino]carbamodithioate is sourced from PubChem (CID 2743511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).