C17H21BrN4O2 — CID 2743625
4-bromo-N'-(4-tert-butylbenzoyl)-1,5-dimethylpyrazole-3-carbohydrazide (PubChem CID 2743625) has the molecular formula C17H21BrN4O2 and a molecular weight of 393.29 g/mol. Its IUPAC name is 4-bromo-N'-(4-tert-butylbenzoyl)-1,5-dimethylpyrazole-3-carbohydrazide.
| Compound Name | 4-bromo-N'-(4-tert-butylbenzoyl)-1,5-dimethylpyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 2743625 |
| Molecular Formula | C17H21BrN4O2 |
| Molecular Weight | 393.29 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 4-bromo-N'-(4-tert-butylbenzoyl)-1,5-dimethylpyrazole-3-carbohydrazide |
| SMILES | Cc1c(Br)c(C(=O)NNC(=O)c2ccc(C(C)(C)C)cc2)nn1C |
| InChI | InChI=1S/C17H21BrN4O2/c1-10-13(18)14(21-22(10)5)16(24)20-19-15(23)11-6-8-12(9-7-11)17(2,3)4/h6-9H,1-5H3,(H,19,23)(H,20,24) |
| InChIKey | DBUXUBOLVIITDJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.29 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|