About [[amino-(5-nitro-1,3-thiazol-2-yl)methylidene]amino] N-phenylcarbamate
[[amino-(5-nitro-1,3-thiazol-2-yl)methylidene]amino] N-phenylcarbamate (PubChem CID 2743684) has the molecular formula C11H9N5O4S
and a molecular weight of 307.29 g/mol. Its IUPAC name is [[amino-(5-nitro-1,3-thiazol-2-yl)methylidene]amino] N-phenylcarbamate.
Molecular Properties
| Compound Name | [[amino-(5-nitro-1,3-thiazol-2-yl)methylidene]amino] N-phenylcarbamate |
| PubChem CID | 2743684 |
| Molecular Formula | C11H9N5O4S |
| Molecular Weight | 307.29 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | [[amino-(5-nitro-1,3-thiazol-2-yl)methylidene]amino] N-phenylcarbamate |
| SMILES | NC(=NOC(=O)Nc1ccccc1)c1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C11H9N5O4S/c12-9(10-13-6-8(21-10)16(18)19)15-20-11(17)14-7-4-2-1-3-5-7/h1-6H,(H2,12,15)(H,14,17) |
| InChIKey | XVAQIIOXHSXZBX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 132.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[amino-(5-nitro-1,3-thiazol-2-yl)methylidene]amino] N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[amino-(5-nitro-1,3-thiazol-2-yl)methylidene]amino] N-phenylcarbamate?
The IUPAC name of [[amino-(5-nitro-1,3-thiazol-2-yl)methylidene]amino] N-phenylcarbamate (CID 2743684) is [[amino-(5-nitro-1,3-thiazol-2-yl)methylidene]amino] N-phenylcarbamate.
What is the SMILES notation for [[amino-(5-nitro-1,3-thiazol-2-yl)methylidene]amino] N-phenylcarbamate?
The canonical SMILES for [[amino-(5-nitro-1,3-thiazol-2-yl)methylidene]amino] N-phenylcarbamate is NC(=NOC(=O)Nc1ccccc1)c1ncc([N+](=O)[O-])s1.
What is the InChIKey of [[amino-(5-nitro-1,3-thiazol-2-yl)methylidene]amino] N-phenylcarbamate?
The InChIKey is XVAQIIOXHSXZBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N5O4S/c12-9(10-13-6-8(21-10)16(18)19)15-20-11(17)14-7-4-2-1-3-5-7/h1-6H,(H2,12,15)(H,14,17).
What are the key properties of [[amino-(5-nitro-1,3-thiazol-2-yl)methylidene]amino] N-phenylcarbamate?
[[amino-(5-nitro-1,3-thiazol-2-yl)methylidene]amino] N-phenylcarbamate has a molecular weight of 307.29 g/mol, XLogP of 1.92, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [[amino-(5-nitro-1,3-thiazol-2-yl)methylidene]amino] N-phenylcarbamate is sourced from PubChem (CID 2743684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).