C11H7N5O2S2 — CID 2743879
5-nitro-2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazole (PubChem CID 2743879) has the molecular formula C11H7N5O2S2 and a molecular weight of 305.34 g/mol. Its IUPAC name is 5-nitro-2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazole.
| Compound Name | 5-nitro-2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazole |
|---|---|
| PubChem CID | 2743879 |
| Molecular Formula | C11H7N5O2S2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.00 |
| IUPAC Name | 5-nitro-2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]-1,3-thiazole |
| SMILES | O=[N+]([O-])c1cnc(Sc2n[nH]c(-c3ccccc3)n2)s1 |
| InChI | InChI=1S/C11H7N5O2S2/c17-16(18)8-6-12-11(19-8)20-10-13-9(14-15-10)7-4-2-1-3-5-7/h1-6H,(H,13,14,15) |
| InChIKey | XQNSZJJUFQZYCZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|