About ethyl 2-[[4-(1,3-dithiolan-2-yl)phenoxy]methyl]-1,3-thiazole-4-carboxylate
ethyl 2-[[4-(1,3-dithiolan-2-yl)phenoxy]methyl]-1,3-thiazole-4-carboxylate (PubChem CID 2743916) has the molecular formula C16H17NO3S3
and a molecular weight of 367.52 g/mol. Its IUPAC name is ethyl 2-[[4-(1,3-dithiolan-2-yl)phenoxy]methyl]-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-[[4-(1,3-dithiolan-2-yl)phenoxy]methyl]-1,3-thiazole-4-carboxylate |
| PubChem CID | 2743916 |
| Molecular Formula | C16H17NO3S3 |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | ethyl 2-[[4-(1,3-dithiolan-2-yl)phenoxy]methyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(COc2ccc(C3SCCS3)cc2)n1 |
| InChI | InChI=1S/C16H17NO3S3/c1-2-19-15(18)13-10-23-14(17-13)9-20-12-5-3-11(4-6-12)16-21-7-8-22-16/h3-6,10,16H,2,7-9H2,1H3 |
| InChIKey | GMOWZTGIUWXBSA-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 2-[[4-(1,3-dithiolan-2-yl)phenoxy]methyl]-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[[4-(1,3-dithiolan-2-yl)phenoxy]methyl]-1,3-thiazole-4-carboxylate?
The IUPAC name of ethyl 2-[[4-(1,3-dithiolan-2-yl)phenoxy]methyl]-1,3-thiazole-4-carboxylate (CID 2743916) is ethyl 2-[[4-(1,3-dithiolan-2-yl)phenoxy]methyl]-1,3-thiazole-4-carboxylate.
What is the SMILES notation for ethyl 2-[[4-(1,3-dithiolan-2-yl)phenoxy]methyl]-1,3-thiazole-4-carboxylate?
The canonical SMILES for ethyl 2-[[4-(1,3-dithiolan-2-yl)phenoxy]methyl]-1,3-thiazole-4-carboxylate is CCOC(=O)c1csc(COc2ccc(C3SCCS3)cc2)n1.
What is the InChIKey of ethyl 2-[[4-(1,3-dithiolan-2-yl)phenoxy]methyl]-1,3-thiazole-4-carboxylate?
The InChIKey is GMOWZTGIUWXBSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO3S3/c1-2-19-15(18)13-10-23-14(17-13)9-20-12-5-3-11(4-6-12)16-21-7-8-22-16/h3-6,10,16H,2,7-9H2,1H3.
What are the key properties of ethyl 2-[[4-(1,3-dithiolan-2-yl)phenoxy]methyl]-1,3-thiazole-4-carboxylate?
ethyl 2-[[4-(1,3-dithiolan-2-yl)phenoxy]methyl]-1,3-thiazole-4-carboxylate has a molecular weight of 367.52 g/mol, XLogP of 4.38, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[[4-(1,3-dithiolan-2-yl)phenoxy]methyl]-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 2743916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).