About ethyl 2-[(4-methoxyphenoxy)methyl]-1,3-thiazole-4-carboxylate
ethyl 2-[(4-methoxyphenoxy)methyl]-1,3-thiazole-4-carboxylate (PubChem CID 2744008) has the molecular formula C14H15NO4S
and a molecular weight of 293.34 g/mol. Its IUPAC name is ethyl 2-[(4-methoxyphenoxy)methyl]-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-[(4-methoxyphenoxy)methyl]-1,3-thiazole-4-carboxylate |
| PubChem CID | 2744008 |
| Molecular Formula | C14H15NO4S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | ethyl 2-[(4-methoxyphenoxy)methyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(COc2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C14H15NO4S/c1-3-18-14(16)12-9-20-13(15-12)8-19-11-6-4-10(17-2)5-7-11/h4-7,9H,3,8H2,1-2H3 |
| InChIKey | NVCLYHADLREICY-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-[(4-methoxyphenoxy)methyl]-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(4-methoxyphenoxy)methyl]-1,3-thiazole-4-carboxylate?
The IUPAC name of ethyl 2-[(4-methoxyphenoxy)methyl]-1,3-thiazole-4-carboxylate (CID 2744008) is ethyl 2-[(4-methoxyphenoxy)methyl]-1,3-thiazole-4-carboxylate.
What is the SMILES notation for ethyl 2-[(4-methoxyphenoxy)methyl]-1,3-thiazole-4-carboxylate?
The canonical SMILES for ethyl 2-[(4-methoxyphenoxy)methyl]-1,3-thiazole-4-carboxylate is CCOC(=O)c1csc(COc2ccc(OC)cc2)n1.
What is the InChIKey of ethyl 2-[(4-methoxyphenoxy)methyl]-1,3-thiazole-4-carboxylate?
The InChIKey is NVCLYHADLREICY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO4S/c1-3-18-14(16)12-9-20-13(15-12)8-19-11-6-4-10(17-2)5-7-11/h4-7,9H,3,8H2,1-2H3.
What are the key properties of ethyl 2-[(4-methoxyphenoxy)methyl]-1,3-thiazole-4-carboxylate?
ethyl 2-[(4-methoxyphenoxy)methyl]-1,3-thiazole-4-carboxylate has a molecular weight of 293.34 g/mol, XLogP of 2.91, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(4-methoxyphenoxy)methyl]-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 2744008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).