About 1-benzyl-4,5-dimethyl-3-pyridin-2-ylsulfonylpyrrol-2-amine
1-benzyl-4,5-dimethyl-3-pyridin-2-ylsulfonylpyrrol-2-amine (PubChem CID 2744024) has the molecular formula C18H19N3O2S
and a molecular weight of 341.44 g/mol. Its IUPAC name is 1-benzyl-4,5-dimethyl-3-pyridin-2-ylsulfonylpyrrol-2-amine.
Molecular Properties
| Compound Name | 1-benzyl-4,5-dimethyl-3-pyridin-2-ylsulfonylpyrrol-2-amine |
| PubChem CID | 2744024 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 1-benzyl-4,5-dimethyl-3-pyridin-2-ylsulfonylpyrrol-2-amine |
| SMILES | Cc1c(S(=O)(=O)c2ccccn2)c(N)n(Cc2ccccc2)c1C |
| InChI | InChI=1S/C18H19N3O2S/c1-13-14(2)21(12-15-8-4-3-5-9-15)18(19)17(13)24(22,23)16-10-6-7-11-20-16/h3-11H,12,19H2,1-2H3 |
| InChIKey | DZTHRJFRPZGMHW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-benzyl-4,5-dimethyl-3-pyridin-2-ylsulfonylpyrrol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-4,5-dimethyl-3-pyridin-2-ylsulfonylpyrrol-2-amine?
The IUPAC name of 1-benzyl-4,5-dimethyl-3-pyridin-2-ylsulfonylpyrrol-2-amine (CID 2744024) is 1-benzyl-4,5-dimethyl-3-pyridin-2-ylsulfonylpyrrol-2-amine.
What is the SMILES notation for 1-benzyl-4,5-dimethyl-3-pyridin-2-ylsulfonylpyrrol-2-amine?
The canonical SMILES for 1-benzyl-4,5-dimethyl-3-pyridin-2-ylsulfonylpyrrol-2-amine is Cc1c(S(=O)(=O)c2ccccn2)c(N)n(Cc2ccccc2)c1C.
What is the InChIKey of 1-benzyl-4,5-dimethyl-3-pyridin-2-ylsulfonylpyrrol-2-amine?
The InChIKey is DZTHRJFRPZGMHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3O2S/c1-13-14(2)21(12-15-8-4-3-5-9-15)18(19)17(13)24(22,23)16-10-6-7-11-20-16/h3-11H,12,19H2,1-2H3.
What are the key properties of 1-benzyl-4,5-dimethyl-3-pyridin-2-ylsulfonylpyrrol-2-amine?
1-benzyl-4,5-dimethyl-3-pyridin-2-ylsulfonylpyrrol-2-amine has a molecular weight of 341.44 g/mol, XLogP of 2.96, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4,5-dimethyl-3-pyridin-2-ylsulfonylpyrrol-2-amine is sourced from PubChem (CID 2744024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).