About 2-(2,4-difluorophenyl)-1,3-thiazole-4-carbohydrazide
2-(2,4-difluorophenyl)-1,3-thiazole-4-carbohydrazide (PubChem CID 2744035) has the molecular formula C10H7F2N3OS
and a molecular weight of 255.25 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1,3-thiazole-4-carbohydrazide.
Molecular Properties
| Compound Name | 2-(2,4-difluorophenyl)-1,3-thiazole-4-carbohydrazide |
| PubChem CID | 2744035 |
| Molecular Formula | C10H7F2N3OS |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1,3-thiazole-4-carbohydrazide |
| SMILES | NNC(=O)c1csc(-c2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C10H7F2N3OS/c11-5-1-2-6(7(12)3-5)10-14-8(4-17-10)9(16)15-13/h1-4H,13H2,(H,15,16) |
| InChIKey | IPTAZOUYWHFMSI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,4-difluorophenyl)-1,3-thiazole-4-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-difluorophenyl)-1,3-thiazole-4-carbohydrazide?
The IUPAC name of 2-(2,4-difluorophenyl)-1,3-thiazole-4-carbohydrazide (CID 2744035) is 2-(2,4-difluorophenyl)-1,3-thiazole-4-carbohydrazide.
What is the SMILES notation for 2-(2,4-difluorophenyl)-1,3-thiazole-4-carbohydrazide?
The canonical SMILES for 2-(2,4-difluorophenyl)-1,3-thiazole-4-carbohydrazide is NNC(=O)c1csc(-c2ccc(F)cc2F)n1.
What is the InChIKey of 2-(2,4-difluorophenyl)-1,3-thiazole-4-carbohydrazide?
The InChIKey is IPTAZOUYWHFMSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7F2N3OS/c11-5-1-2-6(7(12)3-5)10-14-8(4-17-10)9(16)15-13/h1-4H,13H2,(H,15,16).
What are the key properties of 2-(2,4-difluorophenyl)-1,3-thiazole-4-carbohydrazide?
2-(2,4-difluorophenyl)-1,3-thiazole-4-carbohydrazide has a molecular weight of 255.25 g/mol, XLogP of 1.69, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-difluorophenyl)-1,3-thiazole-4-carbohydrazide is sourced from PubChem (CID 2744035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).