C10H8N4S3 — CID 2744111
4-methyl-3-(2-thiophen-2-yl-1,3-thiazol-4-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 2744111) has the molecular formula C10H8N4S3 and a molecular weight of 280.40 g/mol. Its IUPAC name is 4-methyl-3-(2-thiophen-2-yl-1,3-thiazol-4-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-methyl-3-(2-thiophen-2-yl-1,3-thiazol-4-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 2744111 |
| Molecular Formula | C10H8N4S3 |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 279.99 |
| IUPAC Name | 4-methyl-3-(2-thiophen-2-yl-1,3-thiazol-4-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | Cn1c(-c2csc(-c3cccs3)n2)n[nH]c1=S |
| InChI | InChI=1S/C10H8N4S3/c1-14-8(12-13-10(14)15)6-5-17-9(11-6)7-3-2-4-16-7/h2-5H,1H3,(H,13,15) |
| InChIKey | AJABFRMVQFIDKX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|