About [[amino-(2-methyl-1,3-thiazol-4-yl)methylidene]amino] 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate
[[amino-(2-methyl-1,3-thiazol-4-yl)methylidene]amino] 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate (PubChem CID 2744319) has the molecular formula C16H14N4O3S
and a molecular weight of 342.38 g/mol. Its IUPAC name is [[amino-(2-methyl-1,3-thiazol-4-yl)methylidene]amino] 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | [[amino-(2-methyl-1,3-thiazol-4-yl)methylidene]amino] 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate |
| PubChem CID | 2744319 |
| Molecular Formula | C16H14N4O3S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | [[amino-(2-methyl-1,3-thiazol-4-yl)methylidene]amino] 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate |
| SMILES | Cc1nc(C(N)=NOC(=O)c2c(-c3ccccc3)noc2C)cs1 |
| InChI | InChI=1S/C16H14N4O3S/c1-9-13(14(19-22-9)11-6-4-3-5-7-11)16(21)23-20-15(17)12-8-24-10(2)18-12/h3-8H,1-2H3,(H2,17,20) |
| InChIKey | XUYKFGMHCXMECP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[amino-(2-methyl-1,3-thiazol-4-yl)methylidene]amino] 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[amino-(2-methyl-1,3-thiazol-4-yl)methylidene]amino] 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate?
The IUPAC name of [[amino-(2-methyl-1,3-thiazol-4-yl)methylidene]amino] 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate (CID 2744319) is [[amino-(2-methyl-1,3-thiazol-4-yl)methylidene]amino] 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate.
What is the SMILES notation for [[amino-(2-methyl-1,3-thiazol-4-yl)methylidene]amino] 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate?
The canonical SMILES for [[amino-(2-methyl-1,3-thiazol-4-yl)methylidene]amino] 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate is Cc1nc(C(N)=NOC(=O)c2c(-c3ccccc3)noc2C)cs1.
What is the InChIKey of [[amino-(2-methyl-1,3-thiazol-4-yl)methylidene]amino] 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate?
The InChIKey is XUYKFGMHCXMECP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N4O3S/c1-9-13(14(19-22-9)11-6-4-3-5-7-11)16(21)23-20-15(17)12-8-24-10(2)18-12/h3-8H,1-2H3,(H2,17,20).
What are the key properties of [[amino-(2-methyl-1,3-thiazol-4-yl)methylidene]amino] 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate?
[[amino-(2-methyl-1,3-thiazol-4-yl)methylidene]amino] 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate has a molecular weight of 342.38 g/mol, XLogP of 2.89, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [[amino-(2-methyl-1,3-thiazol-4-yl)methylidene]amino] 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate is sourced from PubChem (CID 2744319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).