C21H22N6O4 — CID 27443732
(3S)-1-(4-methoxyphenyl)-N-[[1-(4-methoxyphenyl)tetrazol-5-yl]methyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 27443732) has the molecular formula C21H22N6O4 and a molecular weight of 422.45 g/mol. Its IUPAC name is (3S)-1-(4-methoxyphenyl)-N-[[1-(4-methoxyphenyl)tetrazol-5-yl]methyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-(4-methoxyphenyl)-N-[[1-(4-methoxyphenyl)tetrazol-5-yl]methyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 27443732 |
| Molecular Formula | C21H22N6O4 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | (3S)-1-(4-methoxyphenyl)-N-[[1-(4-methoxyphenyl)tetrazol-5-yl]methyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | COc1ccc(N2C[C@@H](C(=O)NCc3nnnn3-c3ccc(OC)cc3)CC2=O)cc1 |
| InChI | InChI=1S/C21H22N6O4/c1-30-17-7-3-15(4-8-17)26-13-14(11-20(26)28)21(29)22-12-19-23-24-25-27(19)16-5-9-18(31-2)10-6-16/h3-10,14H,11-13H2,1-2H3,(H,22,29)/t14-/m0/s1 |
| InChIKey | AJQNPLSKRSSLIX-AWEZNQCLSA-N |
| XLogP | 1.35 |
| TPSA | 111.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'tetrazole_A(1)', 'substructure': 'N/A'} |
|---|