About 2-[(5-tert-butyl-1H-1,2,4-triazol-3-yl)sulfanyl]-5-(trifluoromethyl)pyridine
2-[(5-tert-butyl-1H-1,2,4-triazol-3-yl)sulfanyl]-5-(trifluoromethyl)pyridine (PubChem CID 2744618) has the molecular formula C12H13F3N4S
and a molecular weight of 302.32 g/mol. Its IUPAC name is 2-[(5-tert-butyl-1H-1,2,4-triazol-3-yl)sulfanyl]-5-(trifluoromethyl)pyridine.
Molecular Properties
| Compound Name | 2-[(5-tert-butyl-1H-1,2,4-triazol-3-yl)sulfanyl]-5-(trifluoromethyl)pyridine |
| PubChem CID | 2744618 |
| Molecular Formula | C12H13F3N4S |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 2-[(5-tert-butyl-1H-1,2,4-triazol-3-yl)sulfanyl]-5-(trifluoromethyl)pyridine |
| SMILES | CC(C)(C)c1nc(Sc2ccc(C(F)(F)F)cn2)n[nH]1 |
| InChI | InChI=1S/C12H13F3N4S/c1-11(2,3)9-17-10(19-18-9)20-8-5-4-7(6-16-8)12(13,14)15/h4-6H,1-3H3,(H,17,18,19) |
| InChIKey | MNNHKXJICQHUMB-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(5-tert-butyl-1H-1,2,4-triazol-3-yl)sulfanyl]-5-(trifluoromethyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-tert-butyl-1H-1,2,4-triazol-3-yl)sulfanyl]-5-(trifluoromethyl)pyridine?
The IUPAC name of 2-[(5-tert-butyl-1H-1,2,4-triazol-3-yl)sulfanyl]-5-(trifluoromethyl)pyridine (CID 2744618) is 2-[(5-tert-butyl-1H-1,2,4-triazol-3-yl)sulfanyl]-5-(trifluoromethyl)pyridine.
What is the SMILES notation for 2-[(5-tert-butyl-1H-1,2,4-triazol-3-yl)sulfanyl]-5-(trifluoromethyl)pyridine?
The canonical SMILES for 2-[(5-tert-butyl-1H-1,2,4-triazol-3-yl)sulfanyl]-5-(trifluoromethyl)pyridine is CC(C)(C)c1nc(Sc2ccc(C(F)(F)F)cn2)n[nH]1.
What is the InChIKey of 2-[(5-tert-butyl-1H-1,2,4-triazol-3-yl)sulfanyl]-5-(trifluoromethyl)pyridine?
The InChIKey is MNNHKXJICQHUMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F3N4S/c1-11(2,3)9-17-10(19-18-9)20-8-5-4-7(6-16-8)12(13,14)15/h4-6H,1-3H3,(H,17,18,19).
What are the key properties of 2-[(5-tert-butyl-1H-1,2,4-triazol-3-yl)sulfanyl]-5-(trifluoromethyl)pyridine?
2-[(5-tert-butyl-1H-1,2,4-triazol-3-yl)sulfanyl]-5-(trifluoromethyl)pyridine has a molecular weight of 302.32 g/mol, XLogP of 3.67, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-tert-butyl-1H-1,2,4-triazol-3-yl)sulfanyl]-5-(trifluoromethyl)pyridine is sourced from PubChem (CID 2744618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).