About 1-[2-(2-chloroanilino)-1,3-thiazol-4-yl]ethanone
1-[2-(2-chloroanilino)-1,3-thiazol-4-yl]ethanone (PubChem CID 2744808) has the molecular formula C11H9ClN2OS
and a molecular weight of 252.73 g/mol. Its IUPAC name is 1-[2-(2-chloroanilino)-1,3-thiazol-4-yl]ethanone.
Molecular Properties
| Compound Name | 1-[2-(2-chloroanilino)-1,3-thiazol-4-yl]ethanone |
| PubChem CID | 2744808 |
| Molecular Formula | C11H9ClN2OS |
| Molecular Weight | 252.73 g/mol |
| Exact Mass | 252.01 |
| IUPAC Name | 1-[2-(2-chloroanilino)-1,3-thiazol-4-yl]ethanone |
| SMILES | CC(=O)c1csc(Nc2ccccc2Cl)n1 |
| InChI | InChI=1S/C11H9ClN2OS/c1-7(15)10-6-16-11(14-10)13-9-5-3-2-4-8(9)12/h2-6H,1H3,(H,13,14) |
| InChIKey | CKTQMHYEPIBWOE-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.73 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-(2-chloroanilino)-1,3-thiazol-4-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(2-chloroanilino)-1,3-thiazol-4-yl]ethanone?
The IUPAC name of 1-[2-(2-chloroanilino)-1,3-thiazol-4-yl]ethanone (CID 2744808) is 1-[2-(2-chloroanilino)-1,3-thiazol-4-yl]ethanone.
What is the SMILES notation for 1-[2-(2-chloroanilino)-1,3-thiazol-4-yl]ethanone?
The canonical SMILES for 1-[2-(2-chloroanilino)-1,3-thiazol-4-yl]ethanone is CC(=O)c1csc(Nc2ccccc2Cl)n1.
What is the InChIKey of 1-[2-(2-chloroanilino)-1,3-thiazol-4-yl]ethanone?
The InChIKey is CKTQMHYEPIBWOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9ClN2OS/c1-7(15)10-6-16-11(14-10)13-9-5-3-2-4-8(9)12/h2-6H,1H3,(H,13,14).
What are the key properties of 1-[2-(2-chloroanilino)-1,3-thiazol-4-yl]ethanone?
1-[2-(2-chloroanilino)-1,3-thiazol-4-yl]ethanone has a molecular weight of 252.73 g/mol, XLogP of 3.74, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2-chloroanilino)-1,3-thiazol-4-yl]ethanone is sourced from PubChem (CID 2744808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).