About S-[5-(trifluoromethyl)-2-pyridinyl] 5-methyl-3-phenyl-1,2-oxazole-4-carbothioate
S-[5-(trifluoromethyl)-2-pyridinyl] 5-methyl-3-phenyl-1,2-oxazole-4-carbothioate (PubChem CID 2744989) has the molecular formula C17H11F3N2O2S
and a molecular weight of 364.35 g/mol. Its IUPAC name is S-[5-(trifluoromethyl)-2-pyridinyl] 5-methyl-3-phenyl-1,2-oxazole-4-carbothioate.
Molecular Properties
| Compound Name | S-[5-(trifluoromethyl)-2-pyridinyl] 5-methyl-3-phenyl-1,2-oxazole-4-carbothioate |
| PubChem CID | 2744989 |
| Molecular Formula | C17H11F3N2O2S |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | S-[5-(trifluoromethyl)-2-pyridinyl] 5-methyl-3-phenyl-1,2-oxazole-4-carbothioate |
| SMILES | Cc1onc(-c2ccccc2)c1C(=O)Sc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C17H11F3N2O2S/c1-10-14(15(22-24-10)11-5-3-2-4-6-11)16(23)25-13-8-7-12(9-21-13)17(18,19)20/h2-9H,1H3 |
| InChIKey | DKNSVDFEUVGFEN-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[5-(trifluoromethyl)-2-pyridinyl] 5-methyl-3-phenyl-1,2-oxazole-4-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[5-(trifluoromethyl)-2-pyridinyl] 5-methyl-3-phenyl-1,2-oxazole-4-carbothioate?
The IUPAC name of S-[5-(trifluoromethyl)-2-pyridinyl] 5-methyl-3-phenyl-1,2-oxazole-4-carbothioate (CID 2744989) is S-[5-(trifluoromethyl)-2-pyridinyl] 5-methyl-3-phenyl-1,2-oxazole-4-carbothioate.
What is the SMILES notation for S-[5-(trifluoromethyl)-2-pyridinyl] 5-methyl-3-phenyl-1,2-oxazole-4-carbothioate?
The canonical SMILES for S-[5-(trifluoromethyl)-2-pyridinyl] 5-methyl-3-phenyl-1,2-oxazole-4-carbothioate is Cc1onc(-c2ccccc2)c1C(=O)Sc1ccc(C(F)(F)F)cn1.
What is the InChIKey of S-[5-(trifluoromethyl)-2-pyridinyl] 5-methyl-3-phenyl-1,2-oxazole-4-carbothioate?
The InChIKey is DKNSVDFEUVGFEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11F3N2O2S/c1-10-14(15(22-24-10)11-5-3-2-4-6-11)16(23)25-13-8-7-12(9-21-13)17(18,19)20/h2-9H,1H3.
What are the key properties of S-[5-(trifluoromethyl)-2-pyridinyl] 5-methyl-3-phenyl-1,2-oxazole-4-carbothioate?
S-[5-(trifluoromethyl)-2-pyridinyl] 5-methyl-3-phenyl-1,2-oxazole-4-carbothioate has a molecular weight of 364.35 g/mol, XLogP of 5.00, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-[5-(trifluoromethyl)-2-pyridinyl] 5-methyl-3-phenyl-1,2-oxazole-4-carbothioate is sourced from PubChem (CID 2744989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).