About S-(2,4-difluorophenyl) 2-[5-[4-(trifluoromethyl)phenyl]tetrazol-2-yl]ethanethioate
S-(2,4-difluorophenyl) 2-[5-[4-(trifluoromethyl)phenyl]tetrazol-2-yl]ethanethioate (PubChem CID 2745011) has the molecular formula C16H9F5N4OS
and a molecular weight of 400.33 g/mol. Its IUPAC name is S-(2,4-difluorophenyl) 2-[5-[4-(trifluoromethyl)phenyl]tetrazol-2-yl]ethanethioate.
Molecular Properties
| Compound Name | S-(2,4-difluorophenyl) 2-[5-[4-(trifluoromethyl)phenyl]tetrazol-2-yl]ethanethioate |
| PubChem CID | 2745011 |
| Molecular Formula | C16H9F5N4OS |
| Molecular Weight | 400.33 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | S-(2,4-difluorophenyl) 2-[5-[4-(trifluoromethyl)phenyl]tetrazol-2-yl]ethanethioate |
| SMILES | O=C(Cn1nnc(-c2ccc(C(F)(F)F)cc2)n1)Sc1ccc(F)cc1F |
| InChI | InChI=1S/C16H9F5N4OS/c17-11-5-6-13(12(18)7-11)27-14(26)8-25-23-15(22-24-25)9-1-3-10(4-2-9)16(19,20)21/h1-7H,8H2 |
| InChIKey | AMLKPCXRPCGFDI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.33 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(2,4-difluorophenyl) 2-[5-[4-(trifluoromethyl)phenyl]tetrazol-2-yl]ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(2,4-difluorophenyl) 2-[5-[4-(trifluoromethyl)phenyl]tetrazol-2-yl]ethanethioate?
The IUPAC name of S-(2,4-difluorophenyl) 2-[5-[4-(trifluoromethyl)phenyl]tetrazol-2-yl]ethanethioate (CID 2745011) is S-(2,4-difluorophenyl) 2-[5-[4-(trifluoromethyl)phenyl]tetrazol-2-yl]ethanethioate.
What is the SMILES notation for S-(2,4-difluorophenyl) 2-[5-[4-(trifluoromethyl)phenyl]tetrazol-2-yl]ethanethioate?
The canonical SMILES for S-(2,4-difluorophenyl) 2-[5-[4-(trifluoromethyl)phenyl]tetrazol-2-yl]ethanethioate is O=C(Cn1nnc(-c2ccc(C(F)(F)F)cc2)n1)Sc1ccc(F)cc1F.
What is the InChIKey of S-(2,4-difluorophenyl) 2-[5-[4-(trifluoromethyl)phenyl]tetrazol-2-yl]ethanethioate?
The InChIKey is AMLKPCXRPCGFDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9F5N4OS/c17-11-5-6-13(12(18)7-11)27-14(26)8-25-23-15(22-24-25)9-1-3-10(4-2-9)16(19,20)21/h1-7H,8H2.
What are the key properties of S-(2,4-difluorophenyl) 2-[5-[4-(trifluoromethyl)phenyl]tetrazol-2-yl]ethanethioate?
S-(2,4-difluorophenyl) 2-[5-[4-(trifluoromethyl)phenyl]tetrazol-2-yl]ethanethioate has a molecular weight of 400.33 g/mol, XLogP of 3.96, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for S-(2,4-difluorophenyl) 2-[5-[4-(trifluoromethyl)phenyl]tetrazol-2-yl]ethanethioate is sourced from PubChem (CID 2745011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).