About 1-(4-fluorophenyl)-N'-(4-methylbenzoyl)-4-oxopyridazine-3-carbohydrazide
1-(4-fluorophenyl)-N'-(4-methylbenzoyl)-4-oxopyridazine-3-carbohydrazide (PubChem CID 2745062) has the molecular formula C19H15FN4O3
and a molecular weight of 366.35 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N'-(4-methylbenzoyl)-4-oxopyridazine-3-carbohydrazide.
Molecular Properties
| Compound Name | 1-(4-fluorophenyl)-N'-(4-methylbenzoyl)-4-oxopyridazine-3-carbohydrazide |
| PubChem CID | 2745062 |
| Molecular Formula | C19H15FN4O3 |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 1-(4-fluorophenyl)-N'-(4-methylbenzoyl)-4-oxopyridazine-3-carbohydrazide |
| SMILES | Cc1ccc(C(=O)NNC(=O)c2nn(-c3ccc(F)cc3)ccc2=O)cc1 |
| InChI | InChI=1S/C19H15FN4O3/c1-12-2-4-13(5-3-12)18(26)21-22-19(27)17-16(25)10-11-24(23-17)15-8-6-14(20)7-9-15/h2-11H,1H3,(H,21,26)(H,22,27) |
| InChIKey | MZJIEYGLEQJHPX-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-fluorophenyl)-N'-(4-methylbenzoyl)-4-oxopyridazine-3-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-fluorophenyl)-N'-(4-methylbenzoyl)-4-oxopyridazine-3-carbohydrazide?
The IUPAC name of 1-(4-fluorophenyl)-N'-(4-methylbenzoyl)-4-oxopyridazine-3-carbohydrazide (CID 2745062) is 1-(4-fluorophenyl)-N'-(4-methylbenzoyl)-4-oxopyridazine-3-carbohydrazide.
What is the SMILES notation for 1-(4-fluorophenyl)-N'-(4-methylbenzoyl)-4-oxopyridazine-3-carbohydrazide?
The canonical SMILES for 1-(4-fluorophenyl)-N'-(4-methylbenzoyl)-4-oxopyridazine-3-carbohydrazide is Cc1ccc(C(=O)NNC(=O)c2nn(-c3ccc(F)cc3)ccc2=O)cc1.
What is the InChIKey of 1-(4-fluorophenyl)-N'-(4-methylbenzoyl)-4-oxopyridazine-3-carbohydrazide?
The InChIKey is MZJIEYGLEQJHPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15FN4O3/c1-12-2-4-13(5-3-12)18(26)21-22-19(27)17-16(25)10-11-24(23-17)15-8-6-14(20)7-9-15/h2-11H,1H3,(H,21,26)(H,22,27).
What are the key properties of 1-(4-fluorophenyl)-N'-(4-methylbenzoyl)-4-oxopyridazine-3-carbohydrazide?
1-(4-fluorophenyl)-N'-(4-methylbenzoyl)-4-oxopyridazine-3-carbohydrazide has a molecular weight of 366.35 g/mol, XLogP of 1.75, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-fluorophenyl)-N'-(4-methylbenzoyl)-4-oxopyridazine-3-carbohydrazide is sourced from PubChem (CID 2745062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).