About 5-(2,4-dichlorophenoxy)-4-methoxy-2,6-dimethylpyrimidine
5-(2,4-dichlorophenoxy)-4-methoxy-2,6-dimethylpyrimidine (PubChem CID 2745080) has the molecular formula C13H12Cl2N2O2
and a molecular weight of 299.16 g/mol. Its IUPAC name is 5-(2,4-dichlorophenoxy)-4-methoxy-2,6-dimethylpyrimidine.
Molecular Properties
| Compound Name | 5-(2,4-dichlorophenoxy)-4-methoxy-2,6-dimethylpyrimidine |
| PubChem CID | 2745080 |
| Molecular Formula | C13H12Cl2N2O2 |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 5-(2,4-dichlorophenoxy)-4-methoxy-2,6-dimethylpyrimidine |
| SMILES | COc1nc(C)nc(C)c1Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H12Cl2N2O2/c1-7-12(13(18-3)17-8(2)16-7)19-11-5-4-9(14)6-10(11)15/h4-6H,1-3H3 |
| InChIKey | LPHNYLSMKZBWLS-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(2,4-dichlorophenoxy)-4-methoxy-2,6-dimethylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,4-dichlorophenoxy)-4-methoxy-2,6-dimethylpyrimidine?
The IUPAC name of 5-(2,4-dichlorophenoxy)-4-methoxy-2,6-dimethylpyrimidine (CID 2745080) is 5-(2,4-dichlorophenoxy)-4-methoxy-2,6-dimethylpyrimidine.
What is the SMILES notation for 5-(2,4-dichlorophenoxy)-4-methoxy-2,6-dimethylpyrimidine?
The canonical SMILES for 5-(2,4-dichlorophenoxy)-4-methoxy-2,6-dimethylpyrimidine is COc1nc(C)nc(C)c1Oc1ccc(Cl)cc1Cl.
What is the InChIKey of 5-(2,4-dichlorophenoxy)-4-methoxy-2,6-dimethylpyrimidine?
The InChIKey is LPHNYLSMKZBWLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12Cl2N2O2/c1-7-12(13(18-3)17-8(2)16-7)19-11-5-4-9(14)6-10(11)15/h4-6H,1-3H3.
What are the key properties of 5-(2,4-dichlorophenoxy)-4-methoxy-2,6-dimethylpyrimidine?
5-(2,4-dichlorophenoxy)-4-methoxy-2,6-dimethylpyrimidine has a molecular weight of 299.16 g/mol, XLogP of 4.20, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,4-dichlorophenoxy)-4-methoxy-2,6-dimethylpyrimidine is sourced from PubChem (CID 2745080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).