C17H17N3O3S — CID 2745223
3-amino-6-(dimethoxymethyl)-N-phenylthieno[2,3-b]pyridine-2-carboxamide (PubChem CID 2745223) has the molecular formula C17H17N3O3S and a molecular weight of 343.41 g/mol. Its IUPAC name is 3-amino-6-(dimethoxymethyl)-N-phenylthieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-6-(dimethoxymethyl)-N-phenylthieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 2745223 |
| Molecular Formula | C17H17N3O3S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 3-amino-6-(dimethoxymethyl)-N-phenylthieno[2,3-b]pyridine-2-carboxamide |
| SMILES | COC(OC)c1ccc2c(N)c(C(=O)Nc3ccccc3)sc2n1 |
| InChI | InChI=1S/C17H17N3O3S/c1-22-17(23-2)12-9-8-11-13(18)14(24-16(11)20-12)15(21)19-10-6-4-3-5-7-10/h3-9,17H,18H2,1-2H3,(H,19,21) |
| InChIKey | YTXKYXLXUFIKFD-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|