About cyclopropyl-[3,5-dimethyl-4-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]pyrazol-1-yl]methanone
cyclopropyl-[3,5-dimethyl-4-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]pyrazol-1-yl]methanone (PubChem CID 2745227) has the molecular formula C15H14F3N3OS
and a molecular weight of 341.36 g/mol. Its IUPAC name is cyclopropyl-[3,5-dimethyl-4-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]pyrazol-1-yl]methanone.
Molecular Properties
| Compound Name | cyclopropyl-[3,5-dimethyl-4-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]pyrazol-1-yl]methanone |
| PubChem CID | 2745227 |
| Molecular Formula | C15H14F3N3OS |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | cyclopropyl-[3,5-dimethyl-4-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]pyrazol-1-yl]methanone |
| SMILES | Cc1nn(C(=O)C2CC2)c(C)c1Sc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C15H14F3N3OS/c1-8-13(9(2)21(20-8)14(22)10-3-4-10)23-12-6-5-11(7-19-12)15(16,17)18/h5-7,10H,3-4H2,1-2H3 |
| InChIKey | KIPURUSAJBRYIB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cyclopropyl-[3,5-dimethyl-4-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]pyrazol-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropyl-[3,5-dimethyl-4-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]pyrazol-1-yl]methanone?
The IUPAC name of cyclopropyl-[3,5-dimethyl-4-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]pyrazol-1-yl]methanone (CID 2745227) is cyclopropyl-[3,5-dimethyl-4-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]pyrazol-1-yl]methanone.
What is the SMILES notation for cyclopropyl-[3,5-dimethyl-4-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]pyrazol-1-yl]methanone?
The canonical SMILES for cyclopropyl-[3,5-dimethyl-4-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]pyrazol-1-yl]methanone is Cc1nn(C(=O)C2CC2)c(C)c1Sc1ccc(C(F)(F)F)cn1.
What is the InChIKey of cyclopropyl-[3,5-dimethyl-4-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]pyrazol-1-yl]methanone?
The InChIKey is KIPURUSAJBRYIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14F3N3OS/c1-8-13(9(2)21(20-8)14(22)10-3-4-10)23-12-6-5-11(7-19-12)15(16,17)18/h5-7,10H,3-4H2,1-2H3.
What are the key properties of cyclopropyl-[3,5-dimethyl-4-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]pyrazol-1-yl]methanone?
cyclopropyl-[3,5-dimethyl-4-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]pyrazol-1-yl]methanone has a molecular weight of 341.36 g/mol, XLogP of 4.12, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropyl-[3,5-dimethyl-4-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]pyrazol-1-yl]methanone is sourced from PubChem (CID 2745227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).