C15H13ClN4O3S — CID 2745260
4-[2-[(4-chlorophenoxy)methyl]-1,3-thiazol-4-yl]-5-methyl-1,2-oxazole-3-carbohydrazide (PubChem CID 2745260) has the molecular formula C15H13ClN4O3S and a molecular weight of 364.81 g/mol. Its IUPAC name is 4-[2-[(4-chlorophenoxy)methyl]-1,3-thiazol-4-yl]-5-methyl-1,2-oxazole-3-carbohydrazide.
| Compound Name | 4-[2-[(4-chlorophenoxy)methyl]-1,3-thiazol-4-yl]-5-methyl-1,2-oxazole-3-carbohydrazide |
|---|---|
| PubChem CID | 2745260 |
| Molecular Formula | C15H13ClN4O3S |
| Molecular Weight | 364.81 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | 4-[2-[(4-chlorophenoxy)methyl]-1,3-thiazol-4-yl]-5-methyl-1,2-oxazole-3-carbohydrazide |
| SMILES | Cc1onc(C(=O)NN)c1-c1csc(COc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C15H13ClN4O3S/c1-8-13(14(20-23-8)15(21)19-17)11-7-24-12(18-11)6-22-10-4-2-9(16)3-5-10/h2-5,7H,6,17H2,1H3,(H,19,21) |
| InChIKey | YJKASRAMMWDASY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.81 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|