C18H22N4O2S — CID 27453362
N-cyclopentyl-3-[2-(phenylcarbamoylamino)-1,3-thiazol-4-yl]propanamide (PubChem CID 27453362) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is N-cyclopentyl-3-[2-(phenylcarbamoylamino)-1,3-thiazol-4-yl]propanamide.
| Compound Name | N-cyclopentyl-3-[2-(phenylcarbamoylamino)-1,3-thiazol-4-yl]propanamide |
|---|---|
| PubChem CID | 27453362 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | N-cyclopentyl-3-[2-(phenylcarbamoylamino)-1,3-thiazol-4-yl]propanamide |
| SMILES | O=C(CCc1csc(NC(=O)Nc2ccccc2)n1)NC1CCCC1 |
| InChI | InChI=1S/C18H22N4O2S/c23-16(19-13-8-4-5-9-13)11-10-15-12-25-18(21-15)22-17(24)20-14-6-2-1-3-7-14/h1-3,6-7,12-13H,4-5,8-11H2,(H,19,23)(H2,20,21,22,24) |
| InChIKey | VMGOXIOIVXBXDE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |