About N-hydroxy-N'-(4-pyridin-3-yl-1,2,5-oxadiazol-3-yl)methanimidamide
N-hydroxy-N'-(4-pyridin-3-yl-1,2,5-oxadiazol-3-yl)methanimidamide (PubChem CID 2745341) has the molecular formula C8H7N5O2
and a molecular weight of 205.18 g/mol. Its IUPAC name is N-hydroxy-N'-(4-pyridin-3-yl-1,2,5-oxadiazol-3-yl)methanimidamide.
Molecular Properties
| Compound Name | N-hydroxy-N'-(4-pyridin-3-yl-1,2,5-oxadiazol-3-yl)methanimidamide |
| PubChem CID | 2745341 |
| Molecular Formula | C8H7N5O2 |
| Molecular Weight | 205.18 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | N-hydroxy-N'-(4-pyridin-3-yl-1,2,5-oxadiazol-3-yl)methanimidamide |
| SMILES | ON/C=N/c1nonc1-c1cccnc1 |
| InChI | InChI=1S/C8H7N5O2/c14-11-5-10-8-7(12-15-13-8)6-2-1-3-9-4-6/h1-5,14H,(H,10,11,13) |
| InChIKey | RYUIHWSTWATILI-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 96.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.18 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxy-N'-(4-pyridin-3-yl-1,2,5-oxadiazol-3-yl)methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxy-N'-(4-pyridin-3-yl-1,2,5-oxadiazol-3-yl)methanimidamide?
The IUPAC name of N-hydroxy-N'-(4-pyridin-3-yl-1,2,5-oxadiazol-3-yl)methanimidamide (CID 2745341) is N-hydroxy-N'-(4-pyridin-3-yl-1,2,5-oxadiazol-3-yl)methanimidamide.
What is the SMILES notation for N-hydroxy-N'-(4-pyridin-3-yl-1,2,5-oxadiazol-3-yl)methanimidamide?
The canonical SMILES for N-hydroxy-N'-(4-pyridin-3-yl-1,2,5-oxadiazol-3-yl)methanimidamide is ON/C=N/c1nonc1-c1cccnc1.
What is the InChIKey of N-hydroxy-N'-(4-pyridin-3-yl-1,2,5-oxadiazol-3-yl)methanimidamide?
The InChIKey is RYUIHWSTWATILI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N5O2/c14-11-5-10-8-7(12-15-13-8)6-2-1-3-9-4-6/h1-5,14H,(H,10,11,13).
What are the key properties of N-hydroxy-N'-(4-pyridin-3-yl-1,2,5-oxadiazol-3-yl)methanimidamide?
N-hydroxy-N'-(4-pyridin-3-yl-1,2,5-oxadiazol-3-yl)methanimidamide has a molecular weight of 205.18 g/mol, XLogP of 0.77, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-N'-(4-pyridin-3-yl-1,2,5-oxadiazol-3-yl)methanimidamide is sourced from PubChem (CID 2745341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).