C19H26N4O3S — CID 27453695
3-[2-[(4-methoxyphenyl)carbamoylamino]-1,3-thiazol-4-yl]-N-pentylpropanamide (PubChem CID 27453695) has the molecular formula C19H26N4O3S and a molecular weight of 390.51 g/mol. Its IUPAC name is 3-[2-[(4-methoxyphenyl)carbamoylamino]-1,3-thiazol-4-yl]-N-pentylpropanamide.
| Compound Name | 3-[2-[(4-methoxyphenyl)carbamoylamino]-1,3-thiazol-4-yl]-N-pentylpropanamide |
|---|---|
| PubChem CID | 27453695 |
| Molecular Formula | C19H26N4O3S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 3-[2-[(4-methoxyphenyl)carbamoylamino]-1,3-thiazol-4-yl]-N-pentylpropanamide |
| SMILES | CCCCCNC(=O)CCc1csc(NC(=O)Nc2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C19H26N4O3S/c1-3-4-5-12-20-17(24)11-8-15-13-27-19(22-15)23-18(25)21-14-6-9-16(26-2)10-7-14/h6-7,9-10,13H,3-5,8,11-12H2,1-2H3,(H,20,24)(H2,21,22,23,25) |
| InChIKey | VCKVOZKYQUCCJX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|