About 3,5,7-trimethyl-[1,2]oxazolo[4,5-d]pyridazin-4-one
3,5,7-trimethyl-[1,2]oxazolo[4,5-d]pyridazin-4-one (PubChem CID 2745399) has the molecular formula C8H9N3O2
and a molecular weight of 179.18 g/mol. Its IUPAC name is 3,5,7-trimethyl-[1,2]oxazolo[4,5-d]pyridazin-4-one.
Analyze 3,5,7-trimethyl-[1,2]oxazolo[4,5-d]pyridazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5,7-trimethyl-[1,2]oxazolo[4,5-d]pyridazin-4-one?
The IUPAC name of 3,5,7-trimethyl-[1,2]oxazolo[4,5-d]pyridazin-4-one (CID 2745399) is 3,5,7-trimethyl-[1,2]oxazolo[4,5-d]pyridazin-4-one.
What is the SMILES notation for 3,5,7-trimethyl-[1,2]oxazolo[4,5-d]pyridazin-4-one?
The canonical SMILES for 3,5,7-trimethyl-[1,2]oxazolo[4,5-d]pyridazin-4-one is Cc1nn(C)c(=O)c2c(C)noc12.
What is the InChIKey of 3,5,7-trimethyl-[1,2]oxazolo[4,5-d]pyridazin-4-one?
The InChIKey is UJCBSLKOIBHRLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O2/c1-4-6-7(13-10-4)5(2)9-11(3)8(6)12/h1-3H3.
What are the key properties of 3,5,7-trimethyl-[1,2]oxazolo[4,5-d]pyridazin-4-one?
3,5,7-trimethyl-[1,2]oxazolo[4,5-d]pyridazin-4-one has a molecular weight of 179.18 g/mol, XLogP of 0.54, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5,7-trimethyl-[1,2]oxazolo[4,5-d]pyridazin-4-one is sourced from PubChem (CID 2745399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).