C13H17N5O3S — CID 2745427
1-[[4-methyl-2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazole-5-carbonyl]amino]-3-propan-2-ylurea (PubChem CID 2745427) has the molecular formula C13H17N5O3S and a molecular weight of 323.38 g/mol. Its IUPAC name is 1-[[4-methyl-2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazole-5-carbonyl]amino]-3-propan-2-ylurea.
| Compound Name | 1-[[4-methyl-2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazole-5-carbonyl]amino]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 2745427 |
| Molecular Formula | C13H17N5O3S |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 1-[[4-methyl-2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazole-5-carbonyl]amino]-3-propan-2-ylurea |
| SMILES | Cc1cc(-c2nc(C)c(C(=O)NNC(=O)NC(C)C)s2)no1 |
| InChI | InChI=1S/C13H17N5O3S/c1-6(2)14-13(20)17-16-11(19)10-8(4)15-12(22-10)9-5-7(3)21-18-9/h5-6H,1-4H3,(H,16,19)(H2,14,17,20) |
| InChIKey | VHCFJSLLQNGAFE-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 109.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|