C17H24N6O2S3 — CID 27454367
3-[2-(cyclohexylcarbamoylamino)-1,3-thiazol-4-yl]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 27454367) has the molecular formula C17H24N6O2S3 and a molecular weight of 440.62 g/mol. Its IUPAC name is 3-[2-(cyclohexylcarbamoylamino)-1,3-thiazol-4-yl]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide.
| Compound Name | 3-[2-(cyclohexylcarbamoylamino)-1,3-thiazol-4-yl]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 27454367 |
| Molecular Formula | C17H24N6O2S3 |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 3-[2-(cyclohexylcarbamoylamino)-1,3-thiazol-4-yl]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)propanamide |
| SMILES | CCSc1nnc(NC(=O)CCc2csc(NC(=O)NC3CCCCC3)n2)s1 |
| InChI | InChI=1S/C17H24N6O2S3/c1-2-26-17-23-22-16(28-17)20-13(24)9-8-12-10-27-15(19-12)21-14(25)18-11-6-4-3-5-7-11/h10-11H,2-9H2,1H3,(H,20,22,24)(H2,18,19,21,25) |
| InChIKey | HEJSEIPTRCSXPF-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 108.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|