C13H10ClN3O — CID 2745567
3-(4-chlorophenyl)-5-methyl-4-(1H-pyrazol-5-yl)-1,2-oxazole (PubChem CID 2745567) has the molecular formula C13H10ClN3O and a molecular weight of 259.70 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-5-methyl-4-(1H-pyrazol-5-yl)-1,2-oxazole.
| Compound Name | 3-(4-chlorophenyl)-5-methyl-4-(1H-pyrazol-5-yl)-1,2-oxazole |
|---|---|
| PubChem CID | 2745567 |
| Molecular Formula | C13H10ClN3O |
| Molecular Weight | 259.70 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 3-(4-chlorophenyl)-5-methyl-4-(1H-pyrazol-5-yl)-1,2-oxazole |
| SMILES | Cc1onc(-c2ccc(Cl)cc2)c1-c1ccn[nH]1 |
| InChI | InChI=1S/C13H10ClN3O/c1-8-12(11-6-7-15-16-11)13(17-18-8)9-2-4-10(14)5-3-9/h2-7H,1H3,(H,15,16) |
| InChIKey | XHCYGHSYBRUUGN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.70 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |