About manganese(2+);bis(5-sulfoquinolin-8-olate)
manganese(2+);bis(5-sulfoquinolin-8-olate) (PubChem CID 27456) has the molecular formula C18H12MnN2O8S2
and a molecular weight of 503.37 g/mol. Its IUPAC name is manganese(2+);bis(5-sulfoquinolin-8-olate).
Molecular Properties
| Compound Name | manganese(2+);bis(5-sulfoquinolin-8-olate) |
| PubChem CID | 27456 |
| Molecular Formula | C18H12MnN2O8S2 |
| Molecular Weight | 503.37 g/mol |
| Exact Mass | 502.94 |
| IUPAC Name | manganese(2+);bis(5-sulfoquinolin-8-olate) |
| SMILES | O=S(=O)(O)c1ccc([O-])c2ncccc12.O=S(=O)(O)c1ccc([O-])c2ncccc12.[Mn+2] |
| InChI | InChI=1S/2C9H7NO4S.Mn/c2*11-7-3-4-8(15(12,13)14)6-2-1-5-10-9(6)7;/h2*1-5,11H,(H,12,13,14);/q;;+2/p-2 |
| InChIKey | QFVBKVUINKWJBW-UHFFFAOYSA-L |
| XLogP | 1.11 |
| TPSA | 180.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 503.37 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze manganese(2+);bis(5-sulfoquinolin-8-olate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of manganese(2+);bis(5-sulfoquinolin-8-olate)?
The IUPAC name of manganese(2+);bis(5-sulfoquinolin-8-olate) (CID 27456) is manganese(2+);bis(5-sulfoquinolin-8-olate).
What is the SMILES notation for manganese(2+);bis(5-sulfoquinolin-8-olate)?
The canonical SMILES for manganese(2+);bis(5-sulfoquinolin-8-olate) is O=S(=O)(O)c1ccc([O-])c2ncccc12.O=S(=O)(O)c1ccc([O-])c2ncccc12.[Mn+2].
What is the InChIKey of manganese(2+);bis(5-sulfoquinolin-8-olate)?
The InChIKey is QFVBKVUINKWJBW-UHFFFAOYSA-L. The full InChI is InChI=1S/2C9H7NO4S.Mn/c2*11-7-3-4-8(15(12,13)14)6-2-1-5-10-9(6)7;/h2*1-5,11H,(H,12,13,14);/q;;+2/p-2.
What are the key properties of manganese(2+);bis(5-sulfoquinolin-8-olate)?
manganese(2+);bis(5-sulfoquinolin-8-olate) has a molecular weight of 503.37 g/mol, XLogP of 1.11, 2 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for manganese(2+);bis(5-sulfoquinolin-8-olate) is sourced from PubChem (CID 27456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).