C19H17ClN2O5S — CID 2745663
methyl 6-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-5-cyano-2-(dimethoxymethyl)pyridine-3-carboxylate (PubChem CID 2745663) has the molecular formula C19H17ClN2O5S and a molecular weight of 420.87 g/mol. Its IUPAC name is methyl 6-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-5-cyano-2-(dimethoxymethyl)pyridine-3-carboxylate.
| Compound Name | methyl 6-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-5-cyano-2-(dimethoxymethyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 2745663 |
| Molecular Formula | C19H17ClN2O5S |
| Molecular Weight | 420.87 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | methyl 6-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-5-cyano-2-(dimethoxymethyl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1cc(C#N)c(SCC(=O)c2ccc(Cl)cc2)nc1C(OC)OC |
| InChI | InChI=1S/C19H17ClN2O5S/c1-25-18(24)14-8-12(9-21)17(22-16(14)19(26-2)27-3)28-10-15(23)11-4-6-13(20)7-5-11/h4-8,19H,10H2,1-3H3 |
| InChIKey | ZFMKXVGLPPVAFB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 98.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.87 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|