C11H13N5O2S2 — CID 2745770
1-methyl-3-[[4-methyl-2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazole-5-carbonyl]amino]thiourea (PubChem CID 2745770) has the molecular formula C11H13N5O2S2 and a molecular weight of 311.39 g/mol. Its IUPAC name is 1-methyl-3-[[4-methyl-2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazole-5-carbonyl]amino]thiourea.
| Compound Name | 1-methyl-3-[[4-methyl-2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazole-5-carbonyl]amino]thiourea |
|---|---|
| PubChem CID | 2745770 |
| Molecular Formula | C11H13N5O2S2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 1-methyl-3-[[4-methyl-2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazole-5-carbonyl]amino]thiourea |
| SMILES | CNC(=S)NNC(=O)c1sc(-c2cc(C)on2)nc1C |
| InChI | InChI=1S/C11H13N5O2S2/c1-5-4-7(16-18-5)10-13-6(2)8(20-10)9(17)14-15-11(19)12-3/h4H,1-3H3,(H,14,17)(H2,12,15,19) |
| InChIKey | KROFPGHAWNKDLJ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|