About 2,3-diethylpyrazine
2,3-diethylpyrazine (PubChem CID 27458) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is 2,3-diethylpyrazine.
Molecular Properties
| Compound Name | 2,3-diethylpyrazine |
| PubChem CID | 27458 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 2,3-diethylpyrazine |
| SMILES | CCc1nccnc1CC |
| InChI | InChI=1S/C8H12N2/c1-3-7-8(4-2)10-6-5-9-7/h5-6H,3-4H2,1-2H3 |
| InChIKey | GZXXANJCCWGCSV-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-diethylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diethylpyrazine?
The IUPAC name of 2,3-diethylpyrazine (CID 27458) is 2,3-diethylpyrazine.
What is the SMILES notation for 2,3-diethylpyrazine?
The canonical SMILES for 2,3-diethylpyrazine is CCc1nccnc1CC.
What is the InChIKey of 2,3-diethylpyrazine?
The InChIKey is GZXXANJCCWGCSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2/c1-3-7-8(4-2)10-6-5-9-7/h5-6H,3-4H2,1-2H3.
What are the key properties of 2,3-diethylpyrazine?
2,3-diethylpyrazine has a molecular weight of 136.20 g/mol, XLogP of 1.60, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diethylpyrazine is sourced from PubChem (CID 27458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).