About S-(4-tert-butylphenyl) 6-(2,2,2-trifluoroethoxy)pyridine-3-carbothioate
S-(4-tert-butylphenyl) 6-(2,2,2-trifluoroethoxy)pyridine-3-carbothioate (PubChem CID 2746131) has the molecular formula C18H18F3NO2S
and a molecular weight of 369.41 g/mol. Its IUPAC name is S-(4-tert-butylphenyl) 6-(2,2,2-trifluoroethoxy)pyridine-3-carbothioate.
Molecular Properties
| Compound Name | S-(4-tert-butylphenyl) 6-(2,2,2-trifluoroethoxy)pyridine-3-carbothioate |
| PubChem CID | 2746131 |
| Molecular Formula | C18H18F3NO2S |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | S-(4-tert-butylphenyl) 6-(2,2,2-trifluoroethoxy)pyridine-3-carbothioate |
| SMILES | CC(C)(C)c1ccc(SC(=O)c2ccc(OCC(F)(F)F)nc2)cc1 |
| InChI | InChI=1S/C18H18F3NO2S/c1-17(2,3)13-5-7-14(8-6-13)25-16(23)12-4-9-15(22-10-12)24-11-18(19,20)21/h4-10H,11H2,1-3H3 |
| InChIKey | FKIWPQDVOKSZGE-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(4-tert-butylphenyl) 6-(2,2,2-trifluoroethoxy)pyridine-3-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(4-tert-butylphenyl) 6-(2,2,2-trifluoroethoxy)pyridine-3-carbothioate?
The IUPAC name of S-(4-tert-butylphenyl) 6-(2,2,2-trifluoroethoxy)pyridine-3-carbothioate (CID 2746131) is S-(4-tert-butylphenyl) 6-(2,2,2-trifluoroethoxy)pyridine-3-carbothioate.
What is the SMILES notation for S-(4-tert-butylphenyl) 6-(2,2,2-trifluoroethoxy)pyridine-3-carbothioate?
The canonical SMILES for S-(4-tert-butylphenyl) 6-(2,2,2-trifluoroethoxy)pyridine-3-carbothioate is CC(C)(C)c1ccc(SC(=O)c2ccc(OCC(F)(F)F)nc2)cc1.
What is the InChIKey of S-(4-tert-butylphenyl) 6-(2,2,2-trifluoroethoxy)pyridine-3-carbothioate?
The InChIKey is FKIWPQDVOKSZGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18F3NO2S/c1-17(2,3)13-5-7-14(8-6-13)25-16(23)12-4-9-15(22-10-12)24-11-18(19,20)21/h4-10H,11H2,1-3H3.
What are the key properties of S-(4-tert-butylphenyl) 6-(2,2,2-trifluoroethoxy)pyridine-3-carbothioate?
S-(4-tert-butylphenyl) 6-(2,2,2-trifluoroethoxy)pyridine-3-carbothioate has a molecular weight of 369.41 g/mol, XLogP of 5.25, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(4-tert-butylphenyl) 6-(2,2,2-trifluoroethoxy)pyridine-3-carbothioate is sourced from PubChem (CID 2746131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).