C14H16ClF3N4OS — CID 2746205
3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methylsulfanyl]-4-pentyl-1H-1,2,4-triazol-5-one (PubChem CID 2746205) has the molecular formula C14H16ClF3N4OS and a molecular weight of 380.82 g/mol. Its IUPAC name is 3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methylsulfanyl]-4-pentyl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methylsulfanyl]-4-pentyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 2746205 |
| Molecular Formula | C14H16ClF3N4OS |
| Molecular Weight | 380.82 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]methylsulfanyl]-4-pentyl-1H-1,2,4-triazol-5-one |
| SMILES | CCCCCn1c(SCc2ncc(C(F)(F)F)cc2Cl)n[nH]c1=O |
| InChI | InChI=1S/C14H16ClF3N4OS/c1-2-3-4-5-22-12(23)20-21-13(22)24-8-11-10(15)6-9(7-19-11)14(16,17)18/h6-7H,2-5,8H2,1H3,(H,20,23) |
| InChIKey | WTPKQYRHKXJJQU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.82 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|