About N-[amino-(2-methyl-1,3-thiazol-4-yl)methylidene]-4-(trifluoromethoxy)benzamide
N-[amino-(2-methyl-1,3-thiazol-4-yl)methylidene]-4-(trifluoromethoxy)benzamide (PubChem CID 2746372) has the molecular formula C13H10F3N3O2S
and a molecular weight of 329.30 g/mol. Its IUPAC name is N-[amino-(2-methyl-1,3-thiazol-4-yl)methylidene]-4-(trifluoromethoxy)benzamide.
Molecular Properties
| Compound Name | N-[amino-(2-methyl-1,3-thiazol-4-yl)methylidene]-4-(trifluoromethoxy)benzamide |
| PubChem CID | 2746372 |
| Molecular Formula | C13H10F3N3O2S |
| Molecular Weight | 329.30 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | N-[amino-(2-methyl-1,3-thiazol-4-yl)methylidene]-4-(trifluoromethoxy)benzamide |
| SMILES | Cc1nc(/C(N)=N/C(=O)c2ccc(OC(F)(F)F)cc2)cs1 |
| InChI | InChI=1S/C13H10F3N3O2S/c1-7-18-10(6-22-7)11(17)19-12(20)8-2-4-9(5-3-8)21-13(14,15)16/h2-6H,1H3,(H2,17,19,20) |
| InChIKey | BZPNKIOZHSQLNC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[amino-(2-methyl-1,3-thiazol-4-yl)methylidene]-4-(trifluoromethoxy)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[amino-(2-methyl-1,3-thiazol-4-yl)methylidene]-4-(trifluoromethoxy)benzamide?
The IUPAC name of N-[amino-(2-methyl-1,3-thiazol-4-yl)methylidene]-4-(trifluoromethoxy)benzamide (CID 2746372) is N-[amino-(2-methyl-1,3-thiazol-4-yl)methylidene]-4-(trifluoromethoxy)benzamide.
What is the SMILES notation for N-[amino-(2-methyl-1,3-thiazol-4-yl)methylidene]-4-(trifluoromethoxy)benzamide?
The canonical SMILES for N-[amino-(2-methyl-1,3-thiazol-4-yl)methylidene]-4-(trifluoromethoxy)benzamide is Cc1nc(/C(N)=N/C(=O)c2ccc(OC(F)(F)F)cc2)cs1.
What is the InChIKey of N-[amino-(2-methyl-1,3-thiazol-4-yl)methylidene]-4-(trifluoromethoxy)benzamide?
The InChIKey is BZPNKIOZHSQLNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10F3N3O2S/c1-7-18-10(6-22-7)11(17)19-12(20)8-2-4-9(5-3-8)21-13(14,15)16/h2-6H,1H3,(H2,17,19,20).
What are the key properties of N-[amino-(2-methyl-1,3-thiazol-4-yl)methylidene]-4-(trifluoromethoxy)benzamide?
N-[amino-(2-methyl-1,3-thiazol-4-yl)methylidene]-4-(trifluoromethoxy)benzamide has a molecular weight of 329.30 g/mol, XLogP of 2.90, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[amino-(2-methyl-1,3-thiazol-4-yl)methylidene]-4-(trifluoromethoxy)benzamide is sourced from PubChem (CID 2746372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).