About 2-(2-oxo-[1,3]oxazolo[4,5-b]pyridin-3-yl)-N-(4-propan-2-ylphenyl)acetamide
2-(2-oxo-[1,3]oxazolo[4,5-b]pyridin-3-yl)-N-(4-propan-2-ylphenyl)acetamide (PubChem CID 2746411) has the molecular formula C17H17N3O3
and a molecular weight of 311.34 g/mol. Its IUPAC name is 2-(2-oxo-[1,3]oxazolo[4,5-b]pyridin-3-yl)-N-(4-propan-2-ylphenyl)acetamide.
Molecular Properties
| Compound Name | 2-(2-oxo-[1,3]oxazolo[4,5-b]pyridin-3-yl)-N-(4-propan-2-ylphenyl)acetamide |
| PubChem CID | 2746411 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 2-(2-oxo-[1,3]oxazolo[4,5-b]pyridin-3-yl)-N-(4-propan-2-ylphenyl)acetamide |
| SMILES | CC(C)c1ccc(NC(=O)Cn2c(=O)oc3cccnc32)cc1 |
| InChI | InChI=1S/C17H17N3O3/c1-11(2)12-5-7-13(8-6-12)19-15(21)10-20-16-14(23-17(20)22)4-3-9-18-16/h3-9,11H,10H2,1-2H3,(H,19,21) |
| InChIKey | LZIPYNJQHIWHOA-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2-oxo-[1,3]oxazolo[4,5-b]pyridin-3-yl)-N-(4-propan-2-ylphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-oxo-[1,3]oxazolo[4,5-b]pyridin-3-yl)-N-(4-propan-2-ylphenyl)acetamide?
The IUPAC name of 2-(2-oxo-[1,3]oxazolo[4,5-b]pyridin-3-yl)-N-(4-propan-2-ylphenyl)acetamide (CID 2746411) is 2-(2-oxo-[1,3]oxazolo[4,5-b]pyridin-3-yl)-N-(4-propan-2-ylphenyl)acetamide.
What is the SMILES notation for 2-(2-oxo-[1,3]oxazolo[4,5-b]pyridin-3-yl)-N-(4-propan-2-ylphenyl)acetamide?
The canonical SMILES for 2-(2-oxo-[1,3]oxazolo[4,5-b]pyridin-3-yl)-N-(4-propan-2-ylphenyl)acetamide is CC(C)c1ccc(NC(=O)Cn2c(=O)oc3cccnc32)cc1.
What is the InChIKey of 2-(2-oxo-[1,3]oxazolo[4,5-b]pyridin-3-yl)-N-(4-propan-2-ylphenyl)acetamide?
The InChIKey is LZIPYNJQHIWHOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N3O3/c1-11(2)12-5-7-13(8-6-12)19-15(21)10-20-16-14(23-17(20)22)4-3-9-18-16/h3-9,11H,10H2,1-2H3,(H,19,21).
What are the key properties of 2-(2-oxo-[1,3]oxazolo[4,5-b]pyridin-3-yl)-N-(4-propan-2-ylphenyl)acetamide?
2-(2-oxo-[1,3]oxazolo[4,5-b]pyridin-3-yl)-N-(4-propan-2-ylphenyl)acetamide has a molecular weight of 311.34 g/mol, XLogP of 2.75, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-oxo-[1,3]oxazolo[4,5-b]pyridin-3-yl)-N-(4-propan-2-ylphenyl)acetamide is sourced from PubChem (CID 2746411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).