About 4-(4-amino-2,5-dichlorophenyl)-2,5-dichloroaniline
4-(4-amino-2,5-dichlorophenyl)-2,5-dichloroaniline (PubChem CID 27465) has the molecular formula C12H8Cl4N2
and a molecular weight of 322.02 g/mol. Its IUPAC name is 4-(4-amino-2,5-dichlorophenyl)-2,5-dichloroaniline.
Molecular Properties
| Compound Name | 4-(4-amino-2,5-dichlorophenyl)-2,5-dichloroaniline |
| PubChem CID | 27465 |
| Molecular Formula | C12H8Cl4N2 |
| Molecular Weight | 322.02 g/mol |
| Exact Mass | 319.94 |
| IUPAC Name | 4-(4-amino-2,5-dichlorophenyl)-2,5-dichloroaniline |
| SMILES | Nc1cc(Cl)c(-c2cc(Cl)c(N)cc2Cl)cc1Cl |
| InChI | InChI=1S/C12H8Cl4N2/c13-7-3-11(17)9(15)1-5(7)6-2-10(16)12(18)4-8(6)14/h1-4H,17-18H2 |
| InChIKey | UXOXUHMFQZEAFR-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.02 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-amino-2,5-dichlorophenyl)-2,5-dichloroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-amino-2,5-dichlorophenyl)-2,5-dichloroaniline?
The IUPAC name of 4-(4-amino-2,5-dichlorophenyl)-2,5-dichloroaniline (CID 27465) is 4-(4-amino-2,5-dichlorophenyl)-2,5-dichloroaniline.
What is the SMILES notation for 4-(4-amino-2,5-dichlorophenyl)-2,5-dichloroaniline?
The canonical SMILES for 4-(4-amino-2,5-dichlorophenyl)-2,5-dichloroaniline is Nc1cc(Cl)c(-c2cc(Cl)c(N)cc2Cl)cc1Cl.
What is the InChIKey of 4-(4-amino-2,5-dichlorophenyl)-2,5-dichloroaniline?
The InChIKey is UXOXUHMFQZEAFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8Cl4N2/c13-7-3-11(17)9(15)1-5(7)6-2-10(16)12(18)4-8(6)14/h1-4H,17-18H2.
What are the key properties of 4-(4-amino-2,5-dichlorophenyl)-2,5-dichloroaniline?
4-(4-amino-2,5-dichlorophenyl)-2,5-dichloroaniline has a molecular weight of 322.02 g/mol, XLogP of 5.13, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-amino-2,5-dichlorophenyl)-2,5-dichloroaniline is sourced from PubChem (CID 27465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).